| Name |
Pimelea factor P2 |
| Formula |
C37H50O9 |
| Mw |
638.3454832 |
| CAS RN |
66107-37-7 |
| C_ID |
C00003469
, 
|
| InChIKey |
IAPHKDDUYAWCMB-MABOCKSRNA-N |
| InChICode |
InChI=1S/C37H50O9/c1-20(2)33-18-22(4)37-26-29(33)44-35(45-33,46-37)17-13-8-6-7-10-14-21(3)25-23(5)28(42-31(39)24-15-11-9-12-16-24)36(41,27(25)37)32(40)34(19-38)30(26)43-34/h9,11-12,15-16,21-23,25-30,32,38,40-41H,1,6-8,10,13-14,17-19H2,2-5H3/t21-,22-,23+,25+,26-,27-,28+,29-,30+,32-,33-,34+,35?,36-,37-/m1/s1 |
| SMILES |
C=C(C)[C@]12C[C@@H](C)[C@@]34OC5(CCCCCCC[C@@H](C)[C@H]6[C@H](C)[C@H](OC(=O)c7ccccc7)[C@@](O)([C@H](O)[C@@]7(CO)O[C@H]7[C@H]3[C@H]1O5)[C@@H]64)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Thymelaeaceae | Daphnopsis spp. | Ref. |
| Plantae | Thymelaeaceae | Dirca occidentalis | Ref. |
| Plantae | Thymelaeaceae | Pimelea spp. | Ref. |
| Plantae | Thymelaeaceae | Synaptolepis spp. | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia retusa | Ref. |
| - | - | family Thymelaeaceae spp. | Ref. |
|
|
zoom in
| Organism | family Thymelaeaceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|