| Name |
Vermeerin |
| Formula |
C15H20O4 |
| Mw |
264.13615913 |
| CAS RN |
16983-23-6 |
| C_ID |
C00003383
, 
|
| InChIKey |
GKYRUDQNQRLJRF-PJHXYDRGNA-N |
| InChICode |
InChI=1S/C15H20O4/c1-8-4-12-10(9(2)14(17)19-12)6-15(3)7-18-13(16)5-11(8)15/h8,10-12H,2,4-7H2,1,3H3/t8-,10-,11+,12+,15-/m1/s1 |
| SMILES |
C=C1C(=O)O[C@H]2C[C@@H](C)[C@@H]3CC(=O)OC[C@@]3(C)C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Hymenoxys anthemoides | Ref. |
| Plantae | Asteraceae | Hymenoxys richardsonii | Ref. |
| Plantae | Asteraceae | Psilostrophe villosa | Ref. |
| Plantae | Rutaceae | Geijera africana | Ref. |
| Plantae | Rutaceae | Geijera aspera | Ref. |
| - | - | family Asteraceae spp. | Ref. |
|
|
zoom in
| Organism | family Asteraceae spp. |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
