| Name |
Matricin |
| Formula |
C17H22O5 |
| Mw |
306.14672381 |
| CAS RN |
29041-35-8 |
| C_ID |
C00003321
, 
|
| InChIKey |
SYTRJRUSWMMZLV-MEULFCEONA-N |
| InChICode |
InChI=1S/C17H22O5/c1-8-7-12(21-10(3)18)13-9(2)16(19)22-15(13)14-11(8)5-6-17(14,4)20/h5-6,9,12-15,20H,7H2,1-4H3/t9-,12-,13+,14-,15-,17-/m0/s1 |
| SMILES |
CC(=O)O[C@H]1CC(C)=C2C=C[C@@](C)(O)[C@@H]2[C@H]2OC(=O)[C@@H](C)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea collina  | Ref. |
| Plantae | Asteraceae | Achillea collina J.Becker ex Reichenb  | Ref. |
| Plantae | Asteraceae | Achillea spp. | Ref. |
| Plantae | Asteraceae | Artemisia arborescens  | Ref. |
| Plantae | Asteraceae | Artemisia caruthii | Ref. |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Jurinea maxima | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
|
|
zoom in
| Organism | Chamomilla rectita | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|