| Name |
Maclurin |
| Formula |
C13H10O6 |
| Mw |
262.04773805 |
| CAS RN |
519-34-6 |
| C_ID |
C00003003
, 
|
| InChIKey |
XNWPXDGRBWJIES-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H10O6/c14-7-4-10(17)12(11(18)5-7)13(19)6-1-2-8(15)9(16)3-6/h1-5,14-18H |
| SMILES |
O=C(c1ccc(O)c(O)c1)c1c(O)cc(O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia multiflora | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xanthochymus | Ref. |
| Plantae | Combretaceae | Laguncularia racemosa | Ref. |
| Plantae | Fabaceae | Acacia spp. | Ref. |
| Plantae | Moraceae | Chlorophora tinctoria | Ref. |
| Plantae | Moraceae | Morus alba | Ref. |
|
|
zoom in
| Organism | Chlorophora tinctoria |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Chiang, et al., Journal of Natural Products, 66, (2003), 1070
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter47 |
|---|
|
