| Name |
2-Methylanthraquinone Tectoquinone 2-Methylanthracene-9,10-dione |
| Formula |
C15H10O2 |
| Mw |
222.06807956 |
| CAS RN |
84-54-8 |
| C_ID |
C00002864
, 
|
| InChIKey |
NJWGQARXZDRHCD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O2/c1-9-6-7-12-13(8-9)15(17)11-5-3-2-4-10(11)14(12)16/h2-8H,1H3 |
| SMILES |
Cc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Newbouldia laevis  | Ref. |
| Plantae | Bignoniaceae | Tecomella undulata  | Ref. |
| Plantae | Euphorbiaceae | Acalypha indica  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia pulcherrima | Ref. |
| Plantae | Euphorbiaceae | Jatropha curcas  | Ref. |
| Plantae | Iridaceae | Iris tectorum  | Ref. |
| Plantae | Labiatae | Tectona grandis  | Ref. |
| Plantae | Lygodiaceae/Schizaeaceae | Lygodium flexuosum  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda lucida  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
| Plantae | Rubiaceae | Morinda umbellata | Ref. |
| Plantae | Rubiaceae | Psychotria serpens  | Ref. |
| Plantae | Rubiaceae | Rubia cordifolia  | Ref. |
| Plantae | Rutaceae | Clausena heptaphylla | Ref. |
| Plantae | Verbenaceae | Lippia sidoides | Ref. |
|
|
zoom in
| Organism | Iris tectorum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Ganapaty, et al., Phytochemistry, 65, (2004), 1265 |
|---|
|