| Name |
Sinapine Sinapoylcholine |
| Formula |
C16H24NO5 |
| Mw |
310.16544788 |
| CAS RN |
18696-26-9 |
| C_ID |
C00002777
, 
|
| InChIKey |
HUJXHFRXWWGYQH-UHFFFAOYSA-O |
| InChICode |
InChI=1S/C16H23NO5/c1-17(2,3)8-9-22-15(18)7-6-12-10-13(20-4)16(19)14(11-12)21-5/h6-7,10-11H,8-9H2,1-5H3/p+1 |
| SMILES |
COc1cc(/C=C/C(=O)OCC[N+](C)(C)C)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica nigra  | Ref. |
| Plantae | Cruciferae | Crambe asiatica | Ref. |
| Plantae | Cruciferae | Draba nemorosa | Ref. |
| Plantae | Cruciferae | Lepidium sativum  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cruciferae | Sinapis alba  | Ref. |
| Plantae | Cruciferae | Sisymbrium columnae | Ref. |
|
|
zoom in
| Organism | Raphanus sativus | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|