| Name |
Purpureaside C |
| Formula |
C35H46O20 |
| Mw |
786.25824391 |
| CAS RN |
108648-07-3 |
| C_ID |
C00002769
, 
|
| InChIKey |
FSBUXLDOLNLABB-ILIGCBMZNA-N |
| InChICode |
InChI=1S/C35H46O20/c1-14-24(42)26(44)29(47)35(51-14)55-32-30(48)34(49-9-8-16-3-6-18(38)20(40)11-16)53-22(13-50-33-28(46)27(45)25(43)21(12-36)52-33)31(32)54-23(41)7-4-15-2-5-17(37)19(39)10-15/h2-7,10-11,14,21-22,24-40,42-48H,8-9,12-13H2,1H3/b7-4+/t14-,21+,22-,24+,25+,26+,27-,28+,29-,30-,31-,32-,33-,34-,35+/m1/s1 |
| SMILES |
CC1O[C@@H](O[C@@H]2C(O)[C@H](OCCc3ccc(O)c(O)c3)OC(CO[C@@H]3OC(CO)[C@H](O)C(O)C3O)[C@H]2OC(=O)/C=C/c2ccc(O)c(O)c2)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Phlomis brunneogaleata | Ref. |
| Plantae | Orobanchaceae | Cistanche deserticola  | Ref. |
| Plantae | Orobanchaceae | Cistanche salsa | Ref. |
| Plantae | Plantaginaceae | Digitalis purpurea  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia nodosa  | Ref. |
|
|
zoom in
| Organism | Scrophularia nodosa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|