| Name |
Estragol Methyl chavicol Estragole Esdragol |
| Formula |
C10H12O |
| Mw |
148.08881501 |
| CAS RN |
140-67-0 |
| C_ID |
C00002740
, 
|
| InChIKey |
ZFMSMUAANRJZFM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3,5-8H,1,4H2,2H3 |
| SMILES |
C=CCc1ccc(OC)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Cyprinidae | Orthodon methylchavicoliferum | Ref. |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Angelica decursiva  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Aristolochiaceae | Asarum heterotropoides var.mandsuricum | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
| Plantae | Asteraceae | Artemisia dracunculus  | Ref. |
| Plantae | Asteraceae | Cyathocline purpurea | Ref. |
| Plantae | Asteraceae | Grindelia paludosa | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
| Plantae | Asteraceae | Solidago odora | Ref. |
| Plantae | Asteraceae | Tagetes florida | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
| Plantae | Euphorbiaceae | Croton zehntneri | Ref. |
| Plantae | Fabaceae | Monopteryx spp. | Ref. |
| Plantae | Illiciaceae | Illicium verum  | Ref. |
| Plantae | Labiatae | Agastache foenicula | Ref. |
| Plantae | Labiatae | Agastache rugosa  | Ref. |
| Plantae | Labiatae | Agastache rugosus | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Lauraceae | Lindera neesiana  | Ref. |
| Plantae | Lauraceae | Persea gratissima  | Ref. |
| Plantae | Magnoliaceae | Magnolia kobus  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Pinaceae | Pinus sylvestris  | Ref. |
| Plantae | Piperaceae | Piper betle  | Ref. |
| Plantae | Plantaginaceae | Limnophila rugosa | Ref. |
| Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
| Plantae | Rutaceae | Dictamnus albus  | Ref. |
| Plantae | Rutaceae | Feronia elephantum  | Ref. |
| Plantae | Rutaceae | Zanthoxylum bungeanum  | Ref. |
|
|
zoom in
| Organism | Foeniculum vulgare | | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|