| Name |
Kadsurin A (+)-Kadsurin A |
| Formula |
C21H24O6 |
| Mw |
372.1572885 |
| CAS RN |
99340-07-5 |
| C_ID |
C00002610
, 
|
| InChIKey |
YVRYZXAHRGGELT-GXPHDMAONA-N |
| InChICode |
InChI=1S/C21H24O6/c1-5-6-15-10-20(23-3)13(2)19(27-21(20,24-4)11-16(15)22)14-7-8-17-18(9-14)26-12-25-17/h5,7-10,13,19H,1,6,11-12H2,2-4H3/t13-,19+,20-,21-/m1/s1 |
| SMILES |
C=CCC1=C[C@]2(OC)[C@H](C)[C@@H](c3ccc4c(c3)OCO4)O[C@]2(OC)CC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Piperaceae | Piper attenuatum  | Ref. |
| Plantae | Piperaceae | Piper futokadsura | Ref. |
| Plantae | Piperaceae | Piper kadsura  | Ref. |
| Plantae | Schisandraceae | Kadsura longipedunculata | Ref. |
| Plantae | Schisandraceae | Kadsura peltigera | Ref. |
|
|
zoom in
| Organism | Kadsura peltigera | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|