| Name |
(-)-Glycinol 3,6a,9-Trihydroxypterocarpan |
| Formula |
C15H12O5 |
| Mw |
272.06847349 |
| CAS RN |
69393-95-9 |
| C_ID |
C00002532
, 
|
| InChIKey |
QMXOFBXZEKTJIK-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C15H12O5/c16-8-1-3-10-12(5-8)19-7-15(18)11-4-2-9(17)6-13(11)20-14(10)15/h1-6,14,16-18H,7H2/t14-,15+/m0/s1 |
| SMILES |
Oc1ccc2c(c1)OC[C@@]1(O)c3ccc(O)cc3O[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina sandwicensis | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Oxyrhynchus volubilis | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Pueraria thunbergiana  | Ref. |
| Plantae | Fabaceae | Teramnus micans | Ref. |
| Plantae | Fabaceae | Teramnus uncinatus | Ref. |
| Plantae | Fabaceae | Vigna mungo  | Ref. |
|
|
zoom in
| Organism | Pueraria thunbergiana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ingham,Z.Naturforsch.C,35,(1980),384
Weinstein,Plant Physiol.,68,(1981),358 |
|---|
|