| Name |
Daphnoretin |
| Formula |
C19H12O7 |
| Mw |
352.05830274 |
| CAS RN |
2034-69-7 |
| C_ID |
C00002463
, 
|
| InChIKey |
JRHMMVBOTXEHGJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H12O7/c1-23-16-6-11-7-17(19(22)26-15(11)9-13(16)20)24-12-4-2-10-3-5-18(21)25-14(10)8-12/h2-9,20H,1H3 |
| SMILES |
COc1cc2cc(Oc3ccc4ccc(=O)oc4c3)c(=O)oc2cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia keiskeana  | Ref. |
| Plantae | Fabaceae | Coronilla coronata | Ref. |
| Plantae | Fabaceae | Coronilla scorpioides | Ref. |
| Plantae | Fabaceae | Hippocrepis spp. | Ref. |
| Plantae | Fabaceae | Securigera cretica | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Thymelaeaceae | Daphne mezereum  | Ref. |
| Plantae | Thymelaeaceae | Daphne odora Thunb.  | Ref. |
| Plantae | Thymelaeaceae | Daphne tangutica | Ref. |
| Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
| Plantae | Thymelaeaceae | Stellera chamaejasme L.  | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia elliptica | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia indica  | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia viridiflora | Ref. |
|
|
zoom in
| Organism | Trifolium repens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|