| Name |
Tremetone |
| Formula |
C13H14O2 |
| Mw |
202.09937969 |
| CAS RN |
4976-25-4 |
| C_ID |
C00002412
, 
|
| InChIKey |
UVYUUQGGBNKRFU-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C13H14O2/c1-8(2)13-7-11-6-10(9(3)14)4-5-12(11)15-13/h4-6,13H,1,7H2,2-3H3/t13-/m1/s1 |
| SMILES |
C=C(C)[C@H]1Cc2cc(C(C)=O)ccc2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina jahnii | Ref. |
| Plantae | Asteraceae | Ageratina spp. | Ref. |
| Plantae | Asteraceae | Baccharis spp. | Ref. |
| Plantae | Asteraceae | Brickellia spp. | Ref. |
| Plantae | Asteraceae | Critonia daleoides | Ref. |
| Plantae | Asteraceae | Eupatorium rugosum | Ref. |
| Plantae | Asteraceae | Eupatorium urticaefolium | Ref. |
| Plantae | Asteraceae | Flourensia fiebrigii | Ref. |
| Plantae | Asteraceae | Grindelia paludosa | Ref. |
| Plantae | Asteraceae | Haplopappus heterophyllus | Ref. |
| Plantae | Asteraceae | Liatris spp. | Ref. |
| Plantae | Asteraceae | Ligularia spp. | Ref. |
| Plantae | Asteraceae | Parastrephia lepidophylla | Ref. |
|
|
zoom in
| Organism | Eupatorium rugosum | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998)
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter33 |
|---|
|