| Name |
Lithospermic acid Lithosperminc acid |
| Formula |
C27H22O12 |
| Mw |
538.11112617 |
| CAS RN |
28831-65-4 |
| C_ID |
C00002400
, 
|
| InChIKey |
UJZQBMQZMKFSRV-ARDNYSISNA-N |
| InChICode |
InChI=1S/C27H22O12/c28-15-5-1-12(9-18(15)31)10-20(26(34)35)38-21(33)8-4-13-2-7-17(30)25-22(13)23(27(36)37)24(39-25)14-3-6-16(29)19(32)11-14/h1-9,11,20,23-24,28-32H,10H2,(H,34,35)(H,36,37)/b8-4+/t20-,23-,24+/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c2c1C(C(=O)O)C(c1ccc(O)c(O)c1)O2)O[C@H](Cc1ccc(O)c(O)c1)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Anchusa officinalis  | Ref. |
| Plantae | Boraginaceae | Echium vulgare  | Ref. |
| Plantae | Boraginaceae | Lithospermum officinalis | Ref. |
| Plantae | Boraginaceae | Lithospermum ruderale | Ref. |
| Plantae | Boraginaceae | Symphytum officinale  | Ref. |
| Plantae | Fagaceae | Lithocarpus officinale | Ref. |
| Plantae | Heliotropiaceae | Tournefortia sarmentosa | Ref. |
| Plantae | Labiatae | Lycopus europaeus  | Ref. |
| Plantae | Labiatae | Lycopus virginicus  | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Salvia cavaleriei | Ref. |
| Plantae | Labiatae | Salvia chinensis | Ref. |
| Plantae | Labiatae | Salvia sonchifolia | Ref. |
|
|
zoom in
| Organism | Lithocarpus officinale | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Lin, et al., Journal of Natural Products, 65, (2002), 745 |
|---|
|