| Name |
Phyllalbine |
| Formula |
C16H21NO4 |
| Mw |
291.14705817 |
| CAS RN |
4540-25-4 |
| C_ID |
C00002298
, 
|
| InChIKey |
OZKTVDIYALBSMA-ISUDBTBINA-N |
| InChICode |
InChI=1S/C16H21NO4/c1-17-11-4-5-12(17)9-13(8-11)21-16(19)10-3-6-14(18)15(7-10)20-2/h3,6-7,11-13,18H,4-5,8-9H2,1-2H3/t11-,12+,13+ |
| SMILES |
COc1cc(C(=O)O[C@H]2CC3CC[C@H](C2)N3C)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Convolvulus subhirsutus | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus discoides  | Ref. |
| Plantae | Solanaceae | Hyoscyamus albus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
|
|
zoom in
| Organism | Hyoscyamus muticus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|