| Name |
Tabernanthine |
| Formula |
C20H26N2O |
| Mw |
310.20451347 |
| CAS RN |
83-94-3 |
| C_ID |
C00001772
, 
|
| InChIKey |
UCIDWKVIQZIKEK-XFDNAQDDNA-N |
| InChICode |
InChI=1S/C20H26N2O/c1-3-13-8-12-9-17-19-16(6-7-22(11-12)20(13)17)15-5-4-14(23-2)10-18(15)21-19/h4-5,10,12-13,17,20-21H,3,6-9,11H2,1-2H3/t12-,13+,17+,20+/m1/s1 |
| SMILES |
CC[C@H]1C[C@@H]2C[C@H]3c4[nH]c5cc(OC)ccc5c4CC[N@@](C2)[C@@H]13 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Conopharyngia spp. | Ref. |
| Plantae | Apocynaceae | Stemmadenia donnell-smithii | Ref. |
| Plantae | Apocynaceae | Stemmadenia spp. | Ref. |
| Plantae | Apocynaceae | Tabernaemontana spp. | Ref. |
| Plantae | Apocynaceae | Tabernanthe iboga  | Ref. |
| - | - | family Apocinaceae spp. | Ref. |
|
|
zoom in
| Organism | family Apocinaceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|