| Name |
Trimethylamine |
| Formula |
C3H9N |
| Mw |
59.07349929 |
| CAS RN |
75-50-3 |
| C_ID |
C00001433
, 
|
| InChIKey |
GETQZCLCWQTVFV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C3H9N/c1-4(2)3/h1-3H3 |
| SMILES |
CN(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Exhaled breath) | Ref. |
| Fungi | Lobariaceae | Lobaria laetevirens | Ref. |
| Fungi | Lobariaceae | Sticta fuliginosa | Ref. |
| Fungi | Lobariaceae | Sticta sylvatica | Ref. |
| Plantae | Apiaceae | Ligusticum chuanxiung | Ref. |
| - | - | Buthus martensi | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Buthus martensi | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|