| Name |
Myristoleic acid |
| Formula |
C14H26O2 |
| Mw |
226.19328007 |
| CAS RN |
544-64-9 |
| C_ID |
C00001229
, 
|
| InChIKey |
YWWVWXASSLXJHU-AATRIKPKSA-N |
| InChICode |
InChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h5-6H,2-4,7-13H2,1H3,(H,15,16)/b6-5+ |
| SMILES |
CCCC/C=C/CCCCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Lauraceae | Cinnamomum comphora | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Palmae | Areca catechu  | Ref. |
| Plantae | Palmae | Elaeis guineensis  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
|
|
zoom in
| Organism | Areca catechu | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Hirao, et al., Yixue Zhongyang Zazhi(Japan), 227, (1967), 138 |
|---|
|