| Name |
Oxalacetic acid Oxaloacetic acid |
| Formula |
C4H4O5 |
| Mw |
132.00587324 |
| CAS RN |
328-42-7 |
| C_ID |
C00001197
, 
|
| InChIKey |
KHPXUQMNIQBQEV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C4H4O5/c5-2(4(8)9)1-3(6)7/h1H2,(H,6,7)(H,8,9) |
| SMILES |
O=C(O)CC(=O)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| -- | Thermotogaceae | Thermotoga maritima | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Celastraceae | Euonymus alatus  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
| Plantae | Poaceae | Hordeum vulgare  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Coleus aromaticus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|