| Name |
Verbascose |
| Formula |
C30H52O26 |
| Mw |
828.27468184 |
| CAS RN |
546-62-3 |
| C_ID |
C00001154
, 
|
| InChIKey |
FLUADVWHMHPUCG-IFGXZQOTNA-N |
| InChICode |
InChI=1S/C30H52O26/c31-1-7-12(34)17(39)21(43)26(51-7)48-3-9-13(35)18(40)22(44)27(52-9)49-4-10-14(36)19(41)23(45)28(53-10)50-5-11-15(37)20(42)24(46)29(54-11)56-30(6-33)25(47)16(38)8(2-32)55-30/h7-29,31-47H,1-6H2/t7-,8+,9-,10-,11+,12-,13-,14-,15-,16-,17-,18-,19-,20-,21+,22+,23-,24+,25+,26-,27-,28-,29+,30-/m0/s1 |
| SMILES |
OCC1O[C@H](OCC2O[C@H](OCC3O[C@H](OCC4O[C@H](O[C@]5(CO)O[C@H](CO)[C@H](O)C5O)C(O)[C@@H](O)[C@H]4O)C(O)[C@@H](O)[C@H]3O)C(O)[C@@H](O)[C@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Vicia faba | Ref. |
| Plantae | Rutaceae | Phellodendron amurense | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
| Plantae | Scrophulariaceae | Verbascum thapsus | Ref. |
| Plantae | Verbenaceae | Lantana camara | Ref. |
|
|
zoom in
| Organism | Lantana camara |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Pan, et al., APS, 27, (1992), 515 |
|---|
|
