| Name |
Agathisflavone |
| Formula |
C30H18O10 |
| Mw |
538.0899968 |
| CAS RN |
28441-98-7 |
| C_ID |
C00001014
, 
|
| InChIKey |
BACLASYRJRZXMY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C30H18O10/c31-15-5-1-13(2-6-15)22-11-20(36)26-24(39-22)12-21(37)27(29(26)38)28-18(34)9-17(33)25-19(35)10-23(40-30(25)28)14-3-7-16(32)8-4-14/h1-12,31-34,37-38H |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2cc(O)c(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc34)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus succedanea  | Ref. |
| Plantae | Araucariaceae | Agathis dammara | Ref. |
| Plantae | Araucariaceae | Agathis palmerstoni | Ref. |
| Plantae | Araucariaceae | Araucaria bidwillii  | Ref. |
| Plantae | Burseraceae | Canarium manii | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xanthochymus  | Ref. |
| Plantae | Fabaceae | Bauhinia vahlii  | Ref. |
| Plantae | Ochnaceae | Ouratea sulcata | Ref. |
|
|
zoom in
| Organism | Garcinia xanthochymus | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|