| Name |
Daidzein 7,4'-Dihydroxyisoflavone |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
486-66-8 |
| C_ID |
C00009380
, 
|
| InChIKey |
ZQSIJRDFPHDXIC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18/h1-8,16-17H |
| SMILES |
O=c1c(-c2ccc(O)cc2)coc2cc(O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Streptomycetaceae | Streptomyces xanthophaeus MD865-C3 | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Fabaceae | Albizia procera  | Ref. |
| Plantae | Fabaceae | Arachis hypogaea  | Ref. |
| Plantae | Fabaceae | Cajanus cajan  | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Crotalaria assamica | Ref. |
| Plantae | Fabaceae | Crotalaria pallida  | Ref. |
| Plantae | Fabaceae | Dalbergia ecastaphyllum  | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Erythrina crista-galli  | Ref. |
| Plantae | Fabaceae | Erythrina indica  | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Erythrina orientalis | Ref. |
| Plantae | Fabaceae | Euchresta formosana | Ref. |
| Plantae | Fabaceae | Genista corsica | Ref. |
| Plantae | Fabaceae | Genista tinctoria  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lespedeza bicolor  | Ref. |
| Plantae | Fabaceae | Maackia amurensis  | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Pericopsis angolensis Baker.  | Ref. |
| Plantae | Fabaceae | Pericopsis eleta | Ref. |
| Plantae | Fabaceae | Pericopsis laxiflora Benth.  | Ref. |
| Plantae | Fabaceae | Pericopsis mooniana | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Piptanthus nepalensis | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
| Plantae | Fabaceae | Pueraria calycina | Ref. |
| Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
| Plantae | Fabaceae | Pueraria edulis | Ref. |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Fabaceae | Pueraria mirifica  | Ref. |
| Plantae | Fabaceae | Pueraria peduncularis | Ref. |
| Plantae | Fabaceae | Pueraria Phaseoloides | Ref. |
| Plantae | Fabaceae | Pueraria thunbergiana  | Ref. |
| Plantae | Fabaceae | Pueraria tuberosa  | Ref. |
| Plantae | Fabaceae | Retama raetam  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Sophora subprostrata | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Trifolium riograndense | Ref. |
| Plantae | Fabaceae | Ulex europaeus  | Ref. |
| Plantae | Fabaceae | Vigna radiata  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Podocarpaceae | Podocarpus amarus | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| - | - | Leguminosae | Ref. |
| - | - | Peuraria lobata | Ref. |
| - | - | Peuraria lobata var.thomsonii | Ref. |
| - | - | Peuraria omeinsis | Ref. |
| - | - | Sarcolobus globosus | Ref. |
|
|
zoom in
| Organism | Pueraria edulis | | Reference | Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Chacha, et al., Phytochemistry, 66, (2005), 99.
Cottiglia, et al., Planta Med, 71, (2005), 254.
Hosny, et al., Journal of Natural Products, 65, (2002), 805.
SUNG, et al., Chem Pharm Bull, 51, (2003), 1429.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995). |
|---|
|