| Name |
Taraxerol Alnulin Skimmiol Tiliadin |
| Formula |
C30H50O |
| Mw |
426.38616622 |
| CAS RN |
127-22-0 |
| C_ID |
C00003758
, 
|
| InChIKey |
GGGUGZHBAOMSFJ-YXYDKRSONA-N |
| InChICode |
InChI=1S/C30H50O/c1-25(2)17-18-27(5)13-9-21-29(7)14-10-20-26(3,4)24(31)12-16-28(20,6)22(29)11-15-30(21,8)23(27)19-25/h9,20,22-24,31H,10-19H2,1-8H3/t20-,22+,23+,24-,27-,28-,29-,30+/m0/s1 |
| SMILES |
CC1(C)CC[C@]2(C)CC=C3[C@]4(C)CC[C@H]5C(C)(C)[C@@H](O)CC[C@]5(C)[C@H]4CC[C@@]3(C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes callosus  | Ref. |
| Plantae | Anacardiaceae | Mangifera persiciformis | Ref. |
| Plantae | Annonaceae | Annona reticulata  | Ref. |
| Plantae | Araliaceae | Acanthopanax trifoliatus  | Ref. |
| Plantae | Asteraceae | Ageratina pichinchensis var. bustamenta | Ref. |
| Plantae | Asteraceae | Launaea nudicaulis  | Ref. |
| Plantae | Asteraceae | Taraxacum officinale  | Ref. |
| Plantae | Asteraceae | Xanthium canadense Mill. | Ref. |
| Plantae | Betulaceae | Alnus glutinosa  | Ref. |
| Plantae | Betulaceae | Alnus incana  | Ref. |
| Plantae | Burseraceae | Canarium spp. | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum bracteatum | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum cordato-oblongum | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum thwaitesii | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum trapezifolium | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum walkeri | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis subglobosa | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis tangshen  | Ref. |
| Plantae | Crassulaceae | Kalanchoe daigremontiana | Ref. |
| Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
| Plantae | Ebenaceae | Diospyros cordifolia  | Ref. |
| Plantae | Ebenaceae | Diospyros ferrea | Ref. |
| Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Ebenaceae | Diospyros lotus  | Ref. |
| Plantae | Ebenaceae | Diospyros mollis  | Ref. |
| Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
| Plantae | Ebenaceae | Diospyros nicaraguensis | Ref. |
| Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
| Plantae | Ebenaceae | Diospyros spp. | Ref. |
| Plantae | Ericaceae | Enkianthus cernuus | Ref. |
| Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
| Plantae | Ericaceae | Pieris japonica D.Don.  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia hirta  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia indica  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia myrsinites | Ref. |
| Plantae | Euphorbiaceae | Excoecaria agallocha L.  | Ref. |
| Plantae | Euphorbiaceae | Macaranga triloba | Ref. |
| Plantae | Euphorbiaceae | Manihot esculenta  | Ref. |
| Plantae | Fabaceae | Dalbergia sericea | Ref. |
| Plantae | Fagaceae | Lithocarpus spp. | Ref. |
| Plantae | Jubulaceae | Frullania fugax | Ref. |
| Plantae | Lauraceae | Litsea dealbata | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Malvaceae | Tilia cordata Mill.  | Ref. |
| Plantae | Myricaceae | Myrica rubra  | Ref. |
| Plantae | Myrsinaceae | Embelia schimperi  | Ref. |
| Plantae | Ranunculaceae | Nigella sativa  | Ref. |
| Plantae | Rhamnaceae | Sageretia theezans  | Ref. |
| Plantae | Rhamnaceae | Ventilago leiocarpa | Ref. |
| Plantae | Rubiaceae | Hedyotis acutangula | Ref. |
| Plantae | Rutaceae | Skimmia japonica | Ref. |
| Plantae | Rutaceae | Skimmia wallachii | Ref. |
| Plantae | Rutaceae | Vepris punctata | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Styracaceae | Styrax japonica | Ref. |
|
|
zoom in
| Organism | Nigella sativa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|