| Name |
alpha-Cubebene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
17699-14-8 |
| C_ID |
C00003120
, 
|
| InChIKey |
XUEHVOLRMXNRKQ-IJGYBCRPNA-N |
| InChICode |
InChI=1S/C15H24/c1-9(2)12-6-5-11(4)15-8-7-10(3)13(15)14(12)15/h7,9,11-14H,5-6,8H2,1-4H3/t11-,12+,13-,14-,15+/m1/s1 |
| SMILES |
CC1=CC[C@@]23[C@@H]([C@@H]12)[C@H](C(C)C)CC[C@H]3C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
| Plantae | Annonaceae | Xylopia frutescens  | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Senecio vulgaris  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Meliaceae | Guarea macrophylla ssp.tuberculata | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Pinaceae | Cedrus libani  | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Pinaceae | Pinus sylvestris  | Ref. |
| Plantae | Piperaceae | Piper arboreum  | Ref. |
| Plantae | Piperaceae | Piper cubeba  | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Piperaceae | Piper obliquum  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rutaceae | Citrus sinensis L.  | Ref. |
| Plantae | Rutaceae | Murraya exotica  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|