| Name |
Afzelin Kaempferol 3-O-rhamnoside Kaempferol 3-O-alpha-rhamnoside Kaempferol 3-O-alpha-L-rhamnopyranoside Kaempferol-3-rhamnoside Kaempherol 3-O-alpha-rhamnoside |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
482-39-3 |
| C_ID |
C00005140
, 
|
| InChIKey |
SOSLMHZOJATCCP-OVDJVLJZNA-N |
| InChICode |
InChI=1S/C21H20O10/c1-8-15(25)17(27)18(28)21(29-8)31-20-16(26)14-12(24)6-11(23)7-13(14)30-19(20)9-2-4-10(22)5-3-9/h2-8,15,17-18,21-25,27-28H,1H3/t8-,15-,17+,18-,21-/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus parviflora  | Ref. |
| Plantae | Annonaceae | Annona purpurea  | Ref. |
| Plantae | Annonaceae | Guatteria rupestris | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Araliaceae | Tetrapanax papyriferus | Ref. |
| Plantae | Asteraceae | Clibadium spp. | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
| Plantae | Betulaceae | Alnus japonica  | Ref. |
| Plantae | Canellaceae | Warburgia stuhlmannii  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium murale  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bancana MIQ  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus controversa  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
| Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cunoniaceae | Davidsonia pruriens  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Ephedraceae | Ephedra alata | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum subsessile | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lunulata  | Ref. |
| Plantae | Euphorbiaceae | Excoecaria cochinchinensis var.viridis  | Ref. |
| Plantae | Euphorbiaceae | Mallotus metcalfianus | Ref. |
| Plantae | Fabaceae | Afzelia spp. | Ref. |
| Plantae | Fabaceae | Cassia grandis  | Ref. |
| Plantae | Fabaceae | Flemingia stricta  | Ref. |
| Plantae | Fabaceae | Millettia zechiana | Ref. |
| Plantae | Fabaceae | Sindora siamensis | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Geraniaceae | Geranium rotundifolium  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris pedata | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris spp. | Ref. |
| Plantae | Juglandaceae | Juglans mandshurica | Ref. |
| Plantae | Labiatae | Ajuga remota  | Ref. |
| Plantae | Lauraceae | Beilschmiedia miersii | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Loranthaceae | Dendrophthoe falcata  | Ref. |
| Plantae | Loranthaceae | Hyphear tanakae | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Nymphaeaceae | Nymphaea odorata  | Ref. |
| Plantae | Ochnaceae | Ochna beddomei  | Ref. |
| Plantae | Onagraceae | Heterogaura heterandra | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Piperaceae | Piper umbellatum  | Ref. |
| Plantae | Platanaceae | Platanus acerifolia | Ref. |
| Plantae | Polygalaceae | Polygala chinensis  | Ref. |
| Plantae | Resedaceae | Ochradenus baccatus  | Ref. |
| Plantae | Rosaceae | Agrimonia eupatoria  | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Rubiaceae | Morinda morindoides | Ref. |
| Plantae | Rutaceae | Euodia alata | Ref. |
| Plantae | Rutaceae | Leptothyrsa sprucei | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Zanthoxylum culantrillo | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saxifragaceae | Heuchera spp. | Ref. |
| Plantae | Saxifragaceae | Lithophragma spp. | Ref. |
| Plantae | Saxifragaceae | Rodgersia podophylla  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Zingiberaceae | Zingiber aromaticum  | Ref. |
| Plantae | Zingiberaceae | Zingiber zerumbe | Ref. |
| Plantae | Zingiberaceae | Zingiber zerumbet  | Ref. |
| - | - | Sarcolaeana multiflora | Ref. |
| - | - | Tapirira guianensis  | Ref. |
|
|
zoom in
| Organism | Hyphear tanakae | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
King, J.Chem.Soc.,(1950),168 |
|---|
|