| Name |
Gentisic acid 2,5-Dihydroxybenzoic acid |
| Formula |
C7H6O4 |
| Mw |
154.02660868 |
| CAS RN |
490-79-9 |
| C_ID |
C00002648
, 
|
| InChIKey |
WXTMDXOMEHJXQO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H6O4/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,8-9H,(H,10,11) |
| SMILES |
O=C(O)c1cc(O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Trichocomaceae | Penicillium citrinum F5 | Ref. |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Asteraceae | Helianthus tuberosus  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cymodoceaceae | Cymodocea rotundata | Ref. |
| Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
| Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
| Plantae | Cymodoceaceae | Halodule wrightii | Ref. |
| Plantae | Cymodoceaceae | Syringodium filiforme | Ref. |
| Plantae | Cymodoceaceae | Syringodium isoetifolium | Ref. |
| Plantae | Cymodoceaceae | Thalassodendron ciliatum | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Gentianaceae | Gentiana spp. | Ref. |
| Plantae | Hydrocharitaceae | Halophila hawaiiana | Ref. |
| Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
| Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myrtaceae | Eucalyptus grandis  | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Pedaliaceae | Sesamum indicum  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Veronica officinalis  | Ref. |
| Plantae | Plantaginaceae | Veronica orchidea | Ref. |
| Plantae | Plantaginaceae | Veronica teucrium | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Citrus cultivars | Ref. |
| Plantae | Rutaceae | Citrus limonia  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
| Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| Plantae | Zosteraceae | Phyllospadix scouleri | Ref. |
| Plantae | Zosteraceae | Phyllospadix serrulatus | Ref. |
| Plantae | Zosteraceae | Zostera capricorni | Ref. |
| Plantae | Zosteraceae | Zostera marina | Ref. |
| - | - | Sarcolaeana multiflora | Ref. |
|
|
zoom in
| Organism | Citrus cultivars | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|