| Name |
D-Sucrose Sucrose (+)-Sucrose Saccharose |
| Formula |
C12H22O11 |
| Mw |
342.11621155 |
| CAS RN |
57-50-1 |
| C_ID |
C00001151
, 
|
| InChIKey |
CZMRCDWAGMRECN-PIZGLXSKNA-N |
| InChICode |
InChI=1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5+,6+,7-,8-,9+,10+,11+,12-/m0/s1 |
| SMILES |
OCC1O[C@H](O[C@]2(CO)O[C@H](CO)C(O)[C@H]2O)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Annonaceae | Xylopia poilanei | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Apiaceae | Pimpinella anisum L.  | Ref. |
| Plantae | Apiaceae | Saposhnikovia divaricata | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Marsdenia tomentosa | Ref. |
| Plantae | Araliaceae | Acanthopanax senticosus  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Araliaceae | Panax quinquefolium  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Robinsonecio gerberifolius | Ref. |
| Plantae | Asteraceae | Stevia rebaudiana  | Ref. |
| Plantae | Asteraceae | Taraxacum officinale  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Rhodiola kirilowii | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asperoides  | Ref. |
| Plantae | Fabaceae | Astragalus membranaceus  | Ref. |
| Plantae | Fabaceae | Astragalus mongholicus | Ref. |
| Plantae | Fabaceae | Caragana microphylla  | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Genista corsica | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Ajuga reptans  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Liliaceae | Fritillaria unibracteata  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Gossypium hirsutum  | Ref. |
| Plantae | Melanthiaceae | Veratrum album  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Orchidaceae | Gastrodia elata  | Ref. |
| Plantae | Paeoniaceae | Paeonia peregrina | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus sellowianus | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Saccharum officinarum  | Ref. |
| Plantae | Poaceae | Sorghum bicolor  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia lingua  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
| Plantae | Polytrichaceae | Polytrichum commune | Ref. |
| Plantae | Pteridaceae | Pteris multifida  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Sapindaceae | Acer saccharum  | Ref. |
| Plantae | Sapotaceae | Sebertia acuminata | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana sylvestris | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Symplocaceae | Symplocos caudata | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Fritillaria unibracteata | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Jiang, et al., Chem Pharm Bull, 53, (2005), 110 |
|---|
|