| Name |
Catalpol |
| Formula |
C15H22O10 |
| Mw |
362.12129692 |
| CAS RN |
2415-24-9 |
| C_ID |
C00003075
, 
|
| InChIKey |
LHDWRKICQLTVDL-ZFYHEPMXNA-N |
| InChICode |
InChI=1S/C15H22O10/c16-3-6-9(19)10(20)11(21)14(23-6)24-13-7-5(1-2-22-13)8(18)12-15(7,4-17)25-12/h1-2,5-14,16-21H,3-4H2/t5-,6+,7+,8-,9+,10-,11+,12-,13-,14-,15+/m0/s1 |
| SMILES |
OCC1O[C@@H](O[C@@H]2OC=C[C@H]3[C@H](O)[C@@H]4O[C@]4(CO)[C@@H]23)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Asystasia intrusa | Ref. |
| Plantae | Bignoniaceae | Argylia radiata | Ref. |
| Plantae | Bignoniaceae | Catalpa ovata  | Ref. |
| Plantae | Bignoniaceae | Catalpa spp. | Ref. |
| Plantae | Buddlejaceae | Buddleia globosa | Ref. |
| Plantae | Buddlejaceae | Buddleia variabilis | Ref. |
| Plantae | Buddlejaceae | Buddleja gloriosa | Ref. |
| Plantae | Buddlejaceae | Buddleja spp. | Ref. |
| Plantae | Buddlejaceae | Buddleja variabilis | Ref. |
| Plantae | Globulariaceae | Globularia trichosantha | Ref. |
| Plantae | Globulariaceae | Globularia vulgaris L. | Ref. |
| Plantae | Labiatae | Gmelina philippensis  | Ref. |
| Plantae | Labiatae | Scutellaria albida subsp.albida | Ref. |
| Plantae | Orobanchaceae | Castilleja integra | Ref. |
| Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
| Plantae | Plantaginaceae | Aragoa cundinamarcensis | Ref. |
| Plantae | Plantaginaceae | Paederota lutea | Ref. |
| Plantae | Plantaginaceae | Penstemon secundiflorus | Ref. |
| Plantae | Plantaginaceae | Picrorhiza scrophulariiflora  | Ref. |
| Plantae | Plantaginaceae | Plantago altissima  | Ref. |
| Plantae | Plantaginaceae | Plantago amplexicaulis | Ref. |
| Plantae | Plantaginaceae | Plantago argentea | Ref. |
| Plantae | Plantaginaceae | Plantago atrata | Ref. |
| Plantae | Plantaginaceae | Plantago cornuti | Ref. |
| Plantae | Plantaginaceae | Plantago hookeriana | Ref. |
| Plantae | Plantaginaceae | Plantago lagopus | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Plantago lundborgii | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
| Plantae | Plantaginaceae | Plantago nivalis | Ref. |
| Plantae | Plantaginaceae | Plantago ovata  | Ref. |
| Plantae | Plantaginaceae | Plantago patagonica | Ref. |
| Plantae | Plantaginaceae | Plantago spp. | Ref. |
| Plantae | Plantaginaceae | Plantago uniflora | Ref. |
| Plantae | Plantaginaceae | Veronica austriaca L.  | Ref. |
| Plantae | Plantaginaceae | Veronica bellidioides | Ref. |
| Plantae | Plantaginaceae | Veronica cuneifolia | Ref. |
| Plantae | Plantaginaceae | Veronica cymbalaria | Ref. |
| Plantae | Plantaginaceae | Veronica francispetae | Ref. |
| Plantae | Plantaginaceae | Veronica ligustrifolia A.Cunn | Ref. |
| Plantae | Plantaginaceae | Veronica longifolia | Ref. |
| Plantae | Plantaginaceae | Veronica pectinata | Ref. |
| Plantae | Plantaginaceae | Veronica perfoliata | Ref. |
| Plantae | Plantaginaceae | Veronica persica  | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica salicifolia G. Forst. | Ref. |
| Plantae | Plantaginaceae | Veronica siaretensis | Ref. |
| Plantae | Plantaginaceae | Veronica spp. | Ref. |
| Plantae | Plantaginaceae | Veronicastrum sibiricum (L.) Pennell | Ref. |
| Plantae | Plantaginaceae | Veronicastrum virginicum (L.) Farw.  | Ref. |
| Plantae | Plantaginaceae | Veronica turrilliana | Ref. |
| Plantae | Plantaginaceae | Veronica x andersonii Lindl. et Pax | Ref. |
| Plantae | Plantaginaceae | Wulfenia baldaccii Degen | Ref. |
| Plantae | Plantaginaceae | Wulfenia blechicii Lakusic subsp. | Ref. |
| Plantae | Plantaginaceae | Wulfenia orientalis BOISS. | Ref. |
| Plantae | Poaceae | Tribolium castaneum | Ref. |
| Plantae | Ranunculaceae | Adonis sutchuenensis | Ref. |
| Plantae | Scrophulariaceae | Camptoloma lyperiiflorum (Vatke) Hillard | Ref. |
| Plantae | Scrophulariaceae | Oreosolen wattii | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia lepidota | Ref. |
| Plantae | Scrophulariaceae | Scrophularia scorodonia | Ref. |
| Plantae | Scrophulariaceae | Scrophularia trifoliata | Ref. |
| Plantae | Scrophulariaceae | Triaenophora rupestris | Ref. |
| Plantae | Scrophulariaceae | Verbascum lychnites | Ref. |
| Plantae | Scrophulariaceae | Verbascum thapsus  | Ref. |
| - | - | Asistasia intrusa | Ref. |
| - | - | Vernoica cymbalaria | Ref. |
|
|
zoom in
| Organism | Veronica pectinata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|