| Name |
(+)-Dihydrokaempferol dihydrokaempferol Dihydrokaempferol (+)-Aromadendrin Katuranin (2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one (2R,3R)-Aromadendrin (+)-(2R,3R)-Dihydrokaempferol Aromadendrin |
| Formula |
C15H12O6 |
| Mw |
288.06338812 |
| CAS RN |
480-20-6 |
| C_ID |
C00007234
, 
|
| InChIKey |
PADQINQHPQKXNL-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C15H12O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,14-18,20H/t14-,15-/m0/s1 |
| SMILES |
O=C1c2c(O)cc(O)cc2O[C@H](c2ccc(O)cc2)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Artemisia vestita  | Ref. |
| Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia schomburgkiana | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica carinata Y line  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis pisifera | Ref. |
| Plantae | Cupressaceae | Juniperus lucayana | Ref. |
| Plantae | Cupressaceae | Thuja orientalis  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Fabaceae | Acacia catechu  | Ref. |
| Plantae | Fabaceae | Afzelia bella | Ref. |
| Plantae | Fabaceae | Cassia fistula  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Spatholobus suberectus Dunn  | Ref. |
| Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Origanum akhadarense | Ref. |
| Plantae | Labiatae | Origanum boissieri | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum compactum  | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum hypercifolium | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum micranthum | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Lamiaceae | Coleus blumei  | Ref. |
| Plantae | Lythraceae | Punica granatum L.  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Malvaceae | Tilia platyphyllos  | Ref. |
| Plantae | Meliaceae | Xylocarpus granatum  | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea  | Ref. |
| Plantae | Moraceae | Maclura tinctoria  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
| Plantae | Myrtaceae | Eucalyptus macathurii | Ref. |
| Plantae | Myrtaceae | Eucalyptus mackliana | Ref. |
| Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus dombeyi  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Pinaceae | Abies lasiocarpa | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Plantaginaceae | Antirrhinum majus  | Ref. |
| Plantae | Platanaceae | Platanus vulgaris | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Podocarpaceae | Podocarpus spp. | Ref. |
| Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
| Plantae | Rhamnaceae | Hovenia dulcis  | Ref. |
| Plantae | Rhamnaceae | Phyllogeiton zeyheri Sond. | Ref. |
| Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
| Plantae | Rhamnaceae | Rhamnus pallasii | Ref. |
| Plantae | Rhamnaceae | Ventilago leiocarpa | Ref. |
| Plantae | Rosaceae | Prunus amygdalus  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus davidiana  | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Flindersia australis | Ref. |
| Plantae | Rutaceae | Phellodendron amurense var.wilsonii  | Ref. |
| Plantae | Salicaceae | Salix caprea  | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Petunia hybrida | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Vitaceae | Ampelopsis brevipedunculata  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Equsetum arvense | Ref. |
| - | - | Nympaea spp. | Ref. |
|
|
zoom in
| Organism | Origanum vulgare subsp. Glandulosum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|