| Name |
Benzoic acid |
| Formula |
C7H6O2 |
| Mw |
122.03677944 |
| CAS RN |
65-85-0 |
| C_ID |
C00000207
, 
|
| InChIKey |
WPYMKLBDIGXBTP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9) |
| SMILES |
O=C(O)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Exhaled breath) | Ref. |
| Animalia | Hominidae | Homo sapiens (Feces) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Fungi | Incertae sedis | Phoma medicaginis | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Uvaria angolensis | Ref. |
| Plantae | Annonaceae | Uvaria mocali | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Araceae | Lemna paucicostata | Ref. |
| Plantae | Asteraceae | Gynura segetum | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Boraginaceae | Onosma hispida  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Colchicaceae | Burchardia multiflora | Ref. |
| Plantae | Convallariaceae | Tupistra chinensis | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica hirta  | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. gongylodes  | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum  | Ref. |
| Plantae | Fabaceae | Dalbergia cochinchinensis | Ref. |
| Plantae | Fabaceae | Dalbergia spruceana | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Senna obtusifolia  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Trifolium incarnatum | Ref. |
| Plantae | Flacourtiaceae | Homalium cochinchinensis  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Lauraceae | Persea americana  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Oleaceae | Nyctanthes arbor-tristis Linn.  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Paeoniaceae | Paeonia albiflora  | Ref. |
| Plantae | Paeoniaceae | Paeonia hybrida | Ref. |
| Plantae | Paeoniaceae | Paeonia lactiflora  | Ref. |
| Plantae | Paeoniaceae | Paeonia peregrina | Ref. |
| Plantae | Paeoniaceae | Paeonia suffruticosa  | Ref. |
| Plantae | Palmae | Daemonorops draco  | Ref. |
| Plantae | Phytolaccaceae | Petiveria alliacea  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Pygeum africanum | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Turneraceae | Turnera ulmifolia  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Bergera koenegii | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Homaliam cochinchinensis | Ref. |
|
|
zoom in
| Organism | Abutilon indicum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|