| Name |
Aceteugenol Acetyl eugenol Eugenol acetate |
| Formula |
C12H14O3 |
| Mw |
206.09429431 |
| CAS RN |
93-28-7 |
| C_ID |
C00053972
|
| InChIKey |
SCCDQYPEOIRVGX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H14O3/c1-4-5-10-6-7-11(15-9(2)13)12(8-10)14-3/h4,6-8H,1,5H2,2-3H3 |
| SMILES |
C=CCc1ccc(OC(C)=O)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Lauraceae | Cinnamomum verum  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia amplexicaulis | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Scrophularia amplexicaulis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|