| Name |
Lactic acid |
| Formula |
C3H6O3 |
| Mw |
90.03169406 |
| CAS RN |
50-21-5 |
| C_ID |
C00050478
|
| InChIKey |
JVTAAEKCZFNVCJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6) |
| SMILES |
CC(O)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Skin) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Gunneraceae | Gunnera sp. | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Plantaginaceae | Digitalis purpurea  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Typhaceae | Typha latifolia  | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Aloe vera | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|