| Name |
Neojusticin B Justicidin C |
| Formula |
C22H18O7 |
| Mw |
394.10525293 |
| CAS RN |
17803-12-2 |
| C_ID |
C00049575
, 
|
| InChIKey |
RHTTTZYNBXNPSZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H18O7/c1-24-16-7-12-13(8-17(16)25-2)21(26-3)20-14(9-27-22(20)23)19(12)11-4-5-15-18(6-11)29-10-28-15/h4-8H,9-10H2,1-3H3 |
| SMILES |
COc1cc2c(OC)c3c(c(-c4ccc5c(c4)OCO5)c2cc1OC)COC3=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Justicia ciliata | Ref. |
| Plantae | Acanthaceae | Justicia procumbens  | Ref. |
| Plantae | Acanthaceae | Justicia simplex | Ref. |
| - | - | Rostellularia procumbens | Ref. |
| - | - | Rostellularia procumbens var.leucantha | Ref. |
|
|
zoom in
| Organism | Rostellularia procumbens var.leucantha | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|