| Name |
Pisiferal (+)-Pisiferal |
| Formula |
C20H28O2 |
| Mw |
300.20893014 |
| CAS RN |
24035-37-8 |
| C_ID |
C00040023
, 
|
| InChIKey |
YPWYNONCSGZEQQ-MQEFSVKANA-N |
| InChICode |
InChI=1S/C20H28O2/c1-13(2)15-10-14-6-7-18-19(3,4)8-5-9-20(18,12-21)16(14)11-17(15)22/h10-13,18,22H,5-9H2,1-4H3/t18-,20-/m0/s1 |
| SMILES |
CC(C)c1cc2c(cc1O)[C@@]1(C=O)CCCC(C)(C)[C@@H]1CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cupressaceae | Chamaecyparis pisifera | Ref. |
| Plantae | Labiatae | Salvia mellifera | Ref. |
| Plantae | Labiatae | Salvia microstegia | Ref. |
| Plantae | Labiatae | Salvia pisidica | Ref. |
| Plantae | Labiatae | Salvia wiedemannii | Ref. |
|
|
zoom in
| Organism | Salvia pisidica | | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
XIAO, et al., Chem Pharm Bull, 49, (2001), 1479 |
|---|
|