| Name |
ent-Kaur-15-en-17-ol |
| Formula |
C20H32O |
| Mw |
288.24531564 |
| CAS RN |
14696-33-4 |
| C_ID |
C00037102
, 
|
| InChIKey |
BYNLGAZDLCEGRX-YBULUQBPNA-N |
| InChICode |
InChI=1S/C20H32O/c1-18(2)8-4-9-19(3)16(18)7-10-20-11-14(5-6-17(19)20)15(12-20)13-21/h12,14,16-17,21H,4-11,13H2,1-3H3/t14-,16+,17-,19+,20+/m0/s1 |
| SMILES |
CC1(C)CCC[C@]2(C)[C@@H]1CC[C@]13C=C(CO)[C@H](CC[C@H]12)C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aristolochiaceae | Aristolochia elegans  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia pubescens | Ref. |
| Plantae | Aristolochiaceae | Aristolochia triangularis | Ref. |
| Plantae | Liliaceae | Fritillaria anhuiensis | Ref. |
| Plantae | Liliaceae | Fritillaria verticillata var.thunbergii  | Ref. |
|
|
zoom in
| Organism | Fritillaria verticillata var.thunbergii | | Reference | Zhou, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 164.
Ruan, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 33, (2002), 858 |
|---|
|