| Name |
Dihydrocarvone
(E)-Dihydrocarvone |
| Formula |
C10H16O |
| Mw |
152.12011513 |
| CAS RN |
5948-04-9 |
| C_ID |
C00037051
, 
|
| InChIKey |
AZOCECCLWFDTAP-MDWBIBFBNA-N |
| InChICode |
InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3/t8-,9-/m1/s1 |
| SMILES |
C=C(C)[C@@H]1CC[C@@H](C)C(=O)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Apium graveolens | Ref. |
| Plantae | Fabaceae | Trifolium pratense | Ref. |
| Plantae | Labiatae | Mentha sauveolens | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus capitatus | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis | Ref. |
| Plantae | Ranunculaceae | Nigella sativa L | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis | Ref. |
|
|
zoom in
| Organism | Thymus broussonetti |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
