| Name |
Angoroside C |
| Formula |
C36H48O19 |
| Mw |
784.27897935 |
| CAS RN |
115909-22-3 |
| C_ID |
C00035177
, 
|
| InChIKey |
KLQXMRBGMLHBBQ-MZEWOYCKNA-N |
| InChICode |
InChI=1S/C36H48O19/c1-16-26(41)28(43)30(45)36(52-16)55-33-31(46)35(49-11-10-18-5-8-22(47-2)20(38)12-18)53-24(15-51-34-29(44)27(42)21(39)14-50-34)32(33)54-25(40)9-6-17-4-7-19(37)23(13-17)48-3/h4-9,12-13,16,21,24,26-39,41-46H,10-11,14-15H2,1-3H3/b9-6+/t16-,21-,24+,26-,27-,28+,29-,30+,31+,32+,33+,34+,35+,36-/m0/s1 |
| SMILES |
COc1ccc(CCO[C@@H]2O[C@H](CO[C@@H]3OC[C@H](O)[C@H](O)[C@H]3O)[C@@H](OC(=O)/C=C/c3ccc(O)c(OC)c3)[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@H]2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Scrophulariaceae | Scrophularia ilwensis | Ref. |
| Plantae | Scrophulariaceae | Scrophularia lepidota | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia nodosa L.  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia scopolii | Ref. |
| - | - | Acrophularia lepidota | Ref. |
|
|
zoom in
| Organism | Scrophularia scopolii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|