| Name |
Specioside (-)-Specioside |
| Formula |
C24H28O12 |
| Mw |
508.15807636 |
| CAS RN |
72514-90-0 |
| C_ID |
C00034894
, 
|
| InChIKey |
SKNVKBJSSSJNCI-YRJOOGIRNA-N |
| InChICode |
InChI=1S/C24H28O12/c25-9-14-17(29)18(30)19(31)23(33-14)35-22-16-13(7-8-32-22)20(21-24(16,10-26)36-21)34-15(28)6-3-11-1-4-12(27)5-2-11/h1-8,13-14,16-23,25-27,29-31H,9-10H2/b6-3+/t13-,14+,16+,17+,18-,19+,20-,21-,22-,23-,24+/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)O[C@H]1[C@@H]2C=CO[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]2[C@@]2(CO)O[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Catalpa speciosa | Ref. |
| Plantae | Bignoniaceae | Stereospermum cylindricum  | Ref. |
| Plantae | Bignoniaceae | Stereospermum personatum  | Ref. |
| Plantae | Plantaginaceae | Picrorhiza scrophulariiflora  | Ref. |
| Plantae | Plantaginaceae | Veronica perfoliata | Ref. |
| Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
|
|
zoom in
| Organism | Veronica perfoliata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|