| Name |
Methyl anthranilate |
| Formula |
C8H9NO2 |
| Mw |
151.06332854 |
| CAS RN |
134-20-3 |
| C_ID |
C00034600
, 
|
| InChIKey |
VAMXMNNIEUEQDV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3 |
| SMILES |
COC(=O)c1ccccc1N |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Asp L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Cruciferae | Hesperis matronalis  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus grandis  | Ref. |
| Plantae | Rutaceae | Citrus hystrix  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|