| Name |
Lineolon Lineolone |
| Formula |
C21H32O5 |
| Mw |
364.22497413 |
| CAS RN |
6869-50-7 |
| C_ID |
C00033120
, 
|
| InChIKey |
YETBVMVJLDSXHU-ZWQCWNERNA-N |
| InChICode |
InChI=1S/C21H32O5/c1-12(22)15-6-9-21(26)19(15,3)17(24)11-16-18(2)7-5-14(23)10-13(18)4-8-20(16,21)25/h4,14-17,23-26H,5-11H2,1-3H3/t14-,15-,16+,17+,18-,19-,20-,21+/m0/s1 |
| SMILES |
CC(=O)[C@@H]1CC[C@@]2(O)[C@]1(C)[C@H](O)C[C@@H]1[C@@]3(C)CC[C@H](O)CC3=CC[C@]12O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Asclepias incarnata | Ref. |
| Plantae | Apocynaceae | Asclepias tuberosa  | Ref. |
| Plantae | Apocynaceae | Cynanchum bungei | Ref. |
| Plantae | Apocynaceae | Cynanchum paniculatum | Ref. |
| Plantae | Apocynaceae | Metaplexis japonica | Ref. |
| Plantae | Ranunculaceae | Adonis amurensis  | Ref. |
|
|
zoom in
| Organism | Metaplexis japonica | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Warashina, et al., Phytochemistry, 53, (2000), 485 |
|---|
|