| Name |
Stigmasta-4,22-dien-3-one (+)-Stigmasta-4,22-dien-3-one |
| Formula |
C29H46O |
| Mw |
410.35486609 |
| CAS RN |
20817-72-5 |
| C_ID |
C00032208
, 
|
| InChIKey |
MKGZDUKUQPPHFM-LEOSSMMNNA-N |
| InChICode |
InChI=1S/C29H46O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-9,18-21,24-27H,7,10-17H2,1-6H3/b9-8+/t20-,21+,24-,25+,26-,27-,28-,29+/m0/s1 |
| SMILES |
CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Inula cappa  | Ref. |
| Plantae | Cannabaceae | Cannabis sativa  | Ref. |
| Plantae | Celastraceae | Microtropis japonica | Ref. |
| Plantae | Jubulaceae | Frullania brasiliensis | Ref. |
| Plantae | Polygonaceae | Polygonum viscosum | Ref. |
| Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
|
|
zoom in
| Organism | Polygonum viscosum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|