| Name |
1,3-Dihydroxy-2-formylanthraquinone Nordamnacanthal |
| Formula |
C15H8O5 |
| Mw |
268.03717337 |
| CAS RN |
3736-59-2 |
| C_ID |
C00032078
, 
|
| InChIKey |
NSGZEHPFOUCUHD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H8O5/c16-6-10-11(17)5-9-12(15(10)20)14(19)8-4-2-1-3-7(8)13(9)18/h1-6,17,20H |
| SMILES |
O=Cc1c(O)cc2c(c1O)C(=O)c1ccccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Coprosma linariifolia Hook.f. | Ref. |
| Plantae | Rubiaceae | Damnacanthus indicus | Ref. |
| Plantae | Rubiaceae | Hymenodictyon excelsum  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia L.  | Ref. |
| Plantae | Rubiaceae | Morinda lucida  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
| Plantae | Rubiaceae | Morinda tinctoria  | Ref. |
| Plantae | Rubiaceae | Neonauclea calycina | Ref. |
| Plantae | Rubiaceae | Rubia cordifolia  | Ref. |
| Plantae | Rubiaceae | Rubia iberica | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana DECNE  | Ref. |
|
|
zoom in
| Organism | Morinda lucida | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Tessier, et al., Planta Med, 41, 337.
WU, et al., Chem Pharm Bull, 51, (2003), 948 |
|---|
|