| Name |
Phaeophytin a
Pheophytin a5
Pheophytin-a |
| Formula |
C55H74N4O5 |
| Mw |
870.5659215 |
| CAS RN |
603-17-8 |
| C_ID |
C00030990
, 
|
| InChIKey |
CQIKWXUXPNUNDV-JOKNFNEPNA-N |
| InChICode |
InChI=1S/C55H74N4O5/c1-13-39-35(8)42-28-44-37(10)41(24-25-48(60)64-27-26-34(7)23-17-22-33(6)21-16-20-32(5)19-15-18-31(3)4)52(58-44)50-51(55(62)63-12)54(61)49-38(11)45(59-53(49)50)30-47-40(14-2)36(9)43(57-47)29-46(39)56-42/h13,26,28-33,37,41,51,56,59H,1,14-25,27H2,2-12H3/b34-26+,42-28-,43-29-,44-28-,45-30-,46-29-,47-30-,52-50-/t32-,33+,37-,41+,51+/m1/s1 |
| SMILES |
C=Cc1c(C)c2cc3nc(c4c5[nH]c(cc6nc(cc1[nH]2)C(C)=C6CC)c(C)c5C(=O)[C@@H]4C(=O)OC)[C@@H](CCC(=O)OC/C=C(C)CCCC(C)CCCC(C)CCCC(C)C)C3C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Labiatae | Ajuga taiwanensis | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
| Plantae | Malvaceae | Sida rhombifolia | Ref. |
| Plantae | Palmae | Cocos nucifera | Ref. |
| Plantae | Turneraceae | Turnera subulata | Ref. |
|
|
zoom in
| Organism | Sida rhombifolia |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
