| Name |
Morellic acid |
| Formula |
C33H36O8 |
| Mw |
560.24101813 |
| CAS RN |
5304-71-2 |
| C_ID |
C00030793
, 
|
| InChIKey |
COVMVPHACFXMAX-JDGBRNQKNA-N |
| InChICode |
InChI=1S/C33H36O8/c1-16(2)8-9-20-26-19(11-12-30(4,5)39-26)24(34)23-25(35)21-14-18-15-22-31(6,7)41-32(28(18)36,13-10-17(3)29(37)38)33(21,22)40-27(20)23/h8,10-12,14,18,22,34H,9,13,15H2,1-7H3,(H,37,38)/b17-10-/t18-,22+,32+,33-/m1/s1 |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c1O[C@]14C(=C[C@@H]5C[C@H]1C(C)(C)O[C@@]4(C/C=C(/C)C(=O)O)C5=O)C3=O)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia gaudichaudii | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hanburyi  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia morella  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia tetralata | Ref. |
|
|
zoom in
| Organism | Garcinia tetralata | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|