| Name |
Eugenin |
| Formula |
C11H10O4 |
| Mw |
206.05790881 |
| CAS RN |
480-34-2 |
| C_ID |
C00030226
, 
|
| InChIKey |
SUTUBQHKZRNZRA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H10O4/c1-6-3-8(12)11-9(13)4-7(14-2)5-10(11)15-6/h3-5,13H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(C)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Coriariaceae | Coriaria japonica  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Crossosomataceae | Crossosoma bigelovii | Ref. |
| Plantae | Juglandaceae | Juglans regia  | Ref. |
| Plantae | Myrtaceae | Eugenia aromatica  | Ref. |
| Plantae | Myrtaceae | Eugenia jambolana  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Myrtaceae | Syzygium cumini  | Ref. |
| Plantae | Paeoniaceae | Paeonia albiflora  | Ref. |
| Plantae | Paeoniaceae | Paeonia lactiflora wild.  | Ref. |
| Plantae | Saxifragaceae | Tellima grandifolia | Ref. |
| Plantae | Simaroubaceae | Harrisonia perforata  | Ref. |
|
|
zoom in
| Organism | Juglans regia | | Reference | Tanaka, et al., Journal of Natural Products, 66, (2003), 759.
Fukuda, et al., Phytochemistry, 63, (2003), 795.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|