| Name |
Diosgenin 3-O-beta-D-glucopyranoside Melongoside B Polygonatoside A Polyphyllin A Prosapogenin D'3 Diosgenin beta-D-glucopyranoside Trillin |
| Formula |
C33H52O8 |
| Mw |
576.36621864 |
| CAS RN |
14144-06-0 |
| C_ID |
C00030141
, 
|
| InChIKey |
WXMARHKAXWRNDM-XSHPNTDWNA-N |
| InChICode |
InChI=1S/C33H52O8/c1-17-7-12-33(38-16-17)18(2)26-24(41-33)14-23-21-6-5-19-13-20(8-10-31(19,3)22(21)9-11-32(23,26)4)39-30-29(37)28(36)27(35)25(15-34)40-30/h5,17-18,20-30,34-37H,6-16H2,1-4H3/t17-,18+,20+,21-,22+,23+,24+,25-,26+,27-,28+,29-,30-,31+,32+,33-/m1/s1 |
| SMILES |
C[C@@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC=C5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convallariaceae | Polygonatum zanlanscianense | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Palmae | Borassus flabellifer  | Ref. |
| Plantae | Solanaceae | Solanum paniculatum | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
|
|
zoom in
| Organism | Tribulus terrestris | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|