| Name |
Chlorogenic acid methyl ester Methyl 5-O-caffeoylquinate Methyl chlorogenate |
| Formula |
C17H20O9 |
| Mw |
368.11073224 |
| CAS RN |
29708-87-0 |
| C_ID |
C00029948
, 
|
| InChIKey |
MZNIJRAPCCELQX-BADWVSBWNA-N |
| InChICode |
InChI=1S/C17H20O9/c1-25-16(23)17(24)7-12(20)15(22)13(8-17)26-14(21)5-3-9-2-4-10(18)11(19)6-9/h2-6,12-13,15,18-20,22,24H,7-8H2,1H3/b5-3+/t12-,13-,15-,17+/m1/s1 |
| SMILES |
COC(=O)[C@]1(O)C[C@@H](O)[C@@H](O)[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Bovidae | Bos taurus domesticus GMELIN  | Ref. |
| Bacteria | Myroidaceae | Myroides sp. SM1 | Ref. |
| Fungi | Trichocomaceae | Penicillium sp. SA29 | Ref. |
| Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium  | Ref. |
| Plantae | Asteraceae | Ageratina adenophora  | Ref. |
| Plantae | Asteraceae | Saussurea medusa | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides  | Ref. |
| Plantae | Rubiaceae | Adina racemosa | Ref. |
| Plantae | Rubiaceae | Sinoadina Racemosa | Ref. |
| Plantae | Sapotaceae | Manilkara zapota cv.Tikal  | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
|
|
zoom in
| Organism | Ageratina adenophora | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|