| Name |
2alpha,3beta-Dihydroxyurs-12-en-28-oic acid 2alpha-Hydroxyursolic acid Corsolic acid Glucosol Corosolic acid |
| Formula |
C30H48O4 |
| Mw |
472.35526002 |
| CAS RN |
4547-24-4 |
| C_ID |
C00029451
, 
|
| InChIKey |
HFGSQOYIOKBQOW-FEBUVDNLNA-N |
| InChICode |
InChI=1S/C30H48O4/c1-17-10-13-30(25(33)34)15-14-28(6)19(23(30)18(17)2)8-9-22-27(5)16-20(31)24(32)26(3,4)21(27)11-12-29(22,28)7/h8,17-18,20-24,31-32H,9-16H2,1-7H3,(H,33,34)/t17-,18+,20-,21+,22-,23+,24+,27+,28-,29-,30+/m1/s1 |
| SMILES |
C[C@H]1[C@H](C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Centella asiatica  | Ref. |
| Plantae | Labiatae | Dracocephalum kotschyi  | Ref. |
| Plantae | Labiatae | Perilla frutescens (L.) Britton var.japonica Hara  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia trijuga | Ref. |
| Plantae | Melastomataceae | Monochaetum vulcanicum | Ref. |
| Plantae | Myrtaceae | Eucalyptus tereticornis  | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendron  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Rosaceae | Chaenomeles sinensis KOEHNE  | Ref. |
| Plantae | Rosaceae | Prunus serrulate var. spontanea | Ref. |
| Plantae | Rosaceae | Rubus alceaefolius | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia gymnanthera | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| - | - | Chamaenerion angustifolium | Ref. |
|
|
zoom in
| Organism | Salvia trijuga | | Reference | Saeidnia, et al., Chem Pharm Bull, 52, (2004), 1249.
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Mu, et al., Acta Botanica Yunnanica(Yunnan Zhiwu Yanjiu), 20, (1998), 123.
Lu, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 21, (1996), 424. |
|---|
|