| Name |
(3Z)-Hexenyl benzoate cis-Hex-3-enyl benzoate (Z)-3-Hexen-1-yl benzoate (Z)-3-Hexenyl benzoate cis-3-Hexenyl benzoate |
| Formula |
C13H16O2 |
| Mw |
204.11502975 |
| CAS RN |
25152-85-6 |
| C_ID |
C00029345
, 
|
| InChIKey |
BCOXBEHFBZOJJZ-ARJAWSKDSA-N |
| InChICode |
InChI=1S/C13H16O2/c1-2-3-4-8-11-15-13(14)12-9-6-5-7-10-12/h3-7,9-10H,2,8,11H2,1H3/b4-3- |
| SMILES |
CC/C=CCCOC(=O)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|