| Name |
Ungeremine |
| Formula |
C16H12NO3 |
| Mw |
266.08171826 |
| CAS RN |
2121-12-2 |
| C_ID |
C00029172
, 
|
| InChIKey |
XHXKHSUJQVCHTA-FWFOQEDRNA-N |
| InChICode |
InChI=1S/C18H21NO5/c1-20-11-6-13-18(17-16(11)24-17)3-4-19(13)7-9-10(18)5-12-15(14(9)21-2)23-8-22-12/h5,11,13,16-17H,3-4,6-8H2,1-2H3/t11-,13-,16+,17+,18+/m1/s1 |
| SMILES |
COc1c2c(cc3c1OCO3)[C@@]13CC[N@@](C2)[C@@H]1C[C@@H](OC)[C@@H]1O[C@@H]13 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Crinum asiaticum  | Ref. |
| Plantae | Amaryllidaceae | Galanthus nivalis  | Ref. |
| Plantae | Amaryllidaceae | Lycoris radiata  | Ref. |
| Plantae | Amaryllidaceae | Narcissus angustifolius subsp. transcanpathicus | Ref. |
| Plantae | Amaryllidaceae | Ungernia minor | Ref. |
|
|
zoom in
| Organism | Ungernia minor | | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Tang, et al., Planta Med, 69, (2003), 97 |
|---|
|