| Name |
beta-Lumicolchicine |
| Formula |
C22H25NO6 |
| Mw |
399.16818754 |
| CAS RN |
6901-13-9 |
| C_ID |
C00027933
, 
|
| InChIKey |
VKPVZFOUXUQJMW-QKFKIEJWNA-N |
| InChICode |
InChI=1S/C22H25NO6/c1-10(24)23-13-7-6-11-8-15(27-3)21(28-4)22(29-5)16(11)17-12-9-14(26-2)20(25)18(12)19(13)17/h8-9,12-13,18H,6-7H2,1-5H3,(H,23,24)/t12-,13-,18?/m0/s1 |
| SMILES |
COC1=C[C@@H]2C3=C([C@@H]2C1=O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c13 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Colchicaceae | Androcymbium capense | Ref. |
| Plantae | Colchicaceae | Androcymbium melanthioides var.stricta Baker. | Ref. |
| Plantae | Colchicaceae | Colchicum autumnale  | Ref. |
| Plantae | Colchicaceae | Colchicum turicum | Ref. |
| Plantae | Colchicaceae | Iphigenia indica | Ref. |
| Plantae | Colchicaceae | Iphigenia stellata | Ref. |
| Plantae | Colchicaceae | Wurmbea dioica F.Muell. | Ref. |
| Plantae | Melanthiaceae | Merendera raddeana | Ref. |
| Plantae | Melanthiaceae | Merendera robusta Bge. | Ref. |
|
|
zoom in
| Organism | Iphigenia indica | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|